C18H22BrFN4O2S — CID 55873107
2-bromo-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-fluorobenzenesulfonamide (PubChem CID 55873107) has the molecular formula C18H22BrFN4O2S and a molecular weight of 457.37 g/mol. Its IUPAC name is 2-bromo-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55873107 |
| Molecular Formula | C18H22BrFN4O2S |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 2-bromo-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-fluorobenzenesulfonamide |
| SMILES | CCN1CCN(c2ccc(CNS(=O)(=O)c3ccc(F)cc3Br)cn2)CC1 |
| InChI | InChI=1S/C18H22BrFN4O2S/c1-2-23-7-9-24(10-8-23)18-6-3-14(12-21-18)13-22-27(25,26)17-5-4-15(20)11-16(17)19/h3-6,11-12,22H,2,7-10,13H2,1H3 |
| InChIKey | GHQMKVYHRFRHSN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |