C21H18Cl2N4O2 — CID 55872180
1-(3-chlorophenyl)-N-[4-chloro-2-(pyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxamide (PubChem CID 55872180) has the molecular formula C21H18Cl2N4O2 and a molecular weight of 429.31 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-chloro-2-(pyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[4-chloro-2-(pyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55872180 |
| Molecular Formula | C21H18Cl2N4O2 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-chloro-2-(pyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)N1CCCC1)c1cnn(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H18Cl2N4O2/c22-15-4-3-5-17(10-15)27-13-14(12-24-27)20(28)25-19-7-6-16(23)11-18(19)21(29)26-8-1-2-9-26/h3-7,10-13H,1-2,8-9H2,(H,25,28) |
| InChIKey | HQOVDIBRRSNEHH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |