C10H12O4S — CID 558725
dimethyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 558725) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is dimethyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 558725 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | dimethyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)C1C2C=CC(S2)C1C(=O)OC |
| InChI | InChI=1S/C10H12O4S/c1-13-9(11)7-5-3-4-6(15-5)8(7)10(12)14-2/h3-8H,1-2H3 |
| InChIKey | XCYJCLXYWBLXAD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|