C13H22O2S — CID 11010140
methyl (1R,5S)-5-pentylsulfanylcyclohex-3-ene-1-carboxylate (PubChem CID 11010140) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is methyl (1R,5S)-5-pentylsulfanylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5S)-5-pentylsulfanylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11010140 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl (1R,5S)-5-pentylsulfanylcyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCS[C@@H]1C=CC[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C13H22O2S/c1-3-4-5-9-16-12-8-6-7-11(10-12)13(14)15-2/h6,8,11-12H,3-5,7,9-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | BLDNWVPORZQXDE-VXGBXAGGSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|