C14H22O2S — CID 162417086
ethyl 3-(4-methylpent-3-enyl)-3,6-dihydro-2H-thiopyran-2-carboxylate (PubChem CID 162417086) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is ethyl 3-(4-methylpent-3-enyl)-3,6-dihydro-2H-thiopyran-2-carboxylate.
| Compound Name | ethyl 3-(4-methylpent-3-enyl)-3,6-dihydro-2H-thiopyran-2-carboxylate |
|---|---|
| PubChem CID | 162417086 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl 3-(4-methylpent-3-enyl)-3,6-dihydro-2H-thiopyran-2-carboxylate |
| SMILES | CCOC(=O)C1SCC=CC1CCC=C(C)C |
| InChI | InChI=1S/C14H22O2S/c1-4-16-14(15)13-12(9-6-10-17-13)8-5-7-11(2)3/h6-7,9,12-13H,4-5,8,10H2,1-3H3 |
| InChIKey | OJTSOIXPDZYKRP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|