About but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate
but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 14660784) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate.
Molecular Properties
| Compound Name | but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| PubChem CID | 14660784 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | C=CCCOC(=O)C1SC2C=CC1C2 |
| InChI | InChI=1S/C11H14O2S/c1-2-3-6-13-11(12)10-8-4-5-9(7-8)14-10/h2,4-5,8-10H,1,3,6-7H2 |
| InChIKey | MEVPOHOXJJTZEX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The IUPAC name of but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate (CID 14660784) is but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate.
What is the SMILES notation for but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The canonical SMILES for but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate is C=CCCOC(=O)C1SC2C=CC1C2.
What is the InChIKey of but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The InChIKey is MEVPOHOXJJTZEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-2-3-6-13-11(12)10-8-4-5-9(7-8)14-10/h2,4-5,8-10H,1,3,6-7H2.
What are the key properties of but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate has a molecular weight of 210.30 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate is sourced from PubChem (CID 14660784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).