About hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate
hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 14660793) has the molecular formula C14H20O2S
and a molecular weight of 252.38 g/mol. Its IUPAC name is hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate.
Molecular Properties
| Compound Name | hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| PubChem CID | 14660793 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | C=CCCCCCOC(=O)C1SC2C=CC1C2 |
| InChI | InChI=1S/C14H20O2S/c1-2-3-4-5-6-9-16-14(15)13-11-7-8-12(10-11)17-13/h2,7-8,11-13H,1,3-6,9-10H2 |
| InChIKey | BSSUGGFNCKPKNL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The IUPAC name of hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate (CID 14660793) is hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate.
What is the SMILES notation for hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The canonical SMILES for hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate is C=CCCCCCOC(=O)C1SC2C=CC1C2.
What is the InChIKey of hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The InChIKey is BSSUGGFNCKPKNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2S/c1-2-3-4-5-6-9-16-14(15)13-11-7-8-12(10-11)17-13/h2,7-8,11-13H,1,3-6,9-10H2.
What are the key properties of hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate has a molecular weight of 252.38 g/mol, XLogP of 3.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate is sourced from PubChem (CID 14660793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).