About hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate
hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 14660790) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate.
Molecular Properties
| Compound Name | hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| PubChem CID | 14660790 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | C=CCCCCOC(=O)C1SC2C=CC1C2 |
| InChI | InChI=1S/C13H18O2S/c1-2-3-4-5-8-15-13(14)12-10-6-7-11(9-10)16-12/h2,6-7,10-12H,1,3-5,8-9H2 |
| InChIKey | BOWMCCLOBSVRSH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The IUPAC name of hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate (CID 14660790) is hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate.
What is the SMILES notation for hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The canonical SMILES for hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate is C=CCCCCOC(=O)C1SC2C=CC1C2.
What is the InChIKey of hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
The InChIKey is BOWMCCLOBSVRSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-2-3-4-5-8-15-13(14)12-10-6-7-11(9-10)16-12/h2,6-7,10-12H,1,3-5,8-9H2.
What are the key properties of hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate?
hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate has a molecular weight of 238.35 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-enyl 2-thiabicyclo[2.2.1]hept-5-ene-3-carboxylate is sourced from PubChem (CID 14660790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).