C9H12O2S — CID 162417251
[(1S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]methyl acetate (PubChem CID 162417251) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is [(1S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]methyl acetate.
| Compound Name | [(1S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 162417251 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | [(1S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1S[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H12O2S/c1-6(10)11-5-9-7-2-3-8(4-7)12-9/h2-3,7-9H,4-5H2,1H3/t7-,8+,9?/m0/s1 |
| InChIKey | JTUNXMKPIXLTIB-ZQTLJVIJSA-N |
| XLogP | 1.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|