C19H22N2OS — CID 55873145
N-(2-cyclopentylsulfanylphenyl)-2,6-dimethylpyridine-3-carboxamide (PubChem CID 55873145) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55873145 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2SC2CCCC2)c(C)n1 |
| InChI | InChI=1S/C19H22N2OS/c1-13-11-12-16(14(2)20-13)19(22)21-17-9-5-6-10-18(17)23-15-7-3-4-8-15/h5-6,9-12,15H,3-4,7-8H2,1-2H3,(H,21,22) |
| InChIKey | FUYYVIBWQPFZTM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |