C20H20F3N3O4S — CID 55873967
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[(2-nitrophenyl)methyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 55873967) has the molecular formula C20H20F3N3O4S and a molecular weight of 455.46 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[(2-nitrophenyl)methyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[(2-nitrophenyl)methyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 55873967 |
| Molecular Formula | C20H20F3N3O4S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[(2-nitrophenyl)methyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | O=C(CCC(=O)N(Cc1ccccc1[N+](=O)[O-])CC(F)(F)F)N1CCc2sccc2C1 |
| InChI | InChI=1S/C20H20F3N3O4S/c21-20(22,23)13-25(11-14-3-1-2-4-16(14)26(29)30)19(28)6-5-18(27)24-9-7-17-15(12-24)8-10-31-17/h1-4,8,10H,5-7,9,11-13H2 |
| InChIKey | DFJOKMAUKRFNDV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|