C23H25N3O2 — CID 55876430
(E)-N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide (PubChem CID 55876430) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (E)-N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55876430 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (E)-N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide |
| SMILES | CCC(C)C(NC(=O)/C=C/c1ccc2c(c1)CCO2)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H25N3O2/c1-3-15(2)22(23-24-18-6-4-5-7-19(18)25-23)26-21(27)11-9-16-8-10-20-17(14-16)12-13-28-20/h4-11,14-15,22H,3,12-13H2,1-2H3,(H,24,25)(H,26,27)/b11-9+ |
| InChIKey | PZFLCRROXQIOGO-PKNBQFBNSA-N |
| XLogP | 4.41 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|