C21H18Cl2N4O4 — CID 55877600
N-[4-(cyclopropylcarbamoylamino)phenyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55877600) has the molecular formula C21H18Cl2N4O4 and a molecular weight of 461.31 g/mol. Its IUPAC name is N-[4-(cyclopropylcarbamoylamino)phenyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[4-(cyclopropylcarbamoylamino)phenyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55877600 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-[4-(cyclopropylcarbamoylamino)phenyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)NC2CC2)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C21H18Cl2N4O4/c1-10(27-19(29)14-8-16(22)17(23)9-15(14)20(27)30)18(28)24-11-2-4-12(5-3-11)25-21(31)26-13-6-7-13/h2-5,8-10,13H,6-7H2,1H3,(H,24,28)(H2,25,26,31) |
| InChIKey | MLJPLXWLTGDREK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|