C22H20Cl2N2O5 — CID 43056010
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide (PubChem CID 43056010) has the molecular formula C22H20Cl2N2O5 and a molecular weight of 463.32 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 43056010 |
| Molecular Formula | C22H20Cl2N2O5 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[3-(oxolan-2-ylmethoxy)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1cccc(OCC2CCCO2)c1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C22H20Cl2N2O5/c1-12(26-21(28)16-9-18(23)19(24)10-17(16)22(26)29)20(27)25-13-4-2-5-14(8-13)31-11-15-6-3-7-30-15/h2,4-5,8-10,12,15H,3,6-7,11H2,1H3,(H,25,27) |
| InChIKey | MXENCEWEXKAJTD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|