C17H26N2O4 — CID 95288894
1-[(2S)-4-methoxybutan-2-yl]-3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea (PubChem CID 95288894) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(2S)-4-methoxybutan-2-yl]-3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea.
| Compound Name | 1-[(2S)-4-methoxybutan-2-yl]-3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea |
|---|---|
| PubChem CID | 95288894 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(2S)-4-methoxybutan-2-yl]-3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea |
| SMILES | COCC[C@H](C)NC(=O)Nc1cccc(OC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-13(8-10-21-2)18-17(20)19-14-5-3-6-15(11-14)23-12-16-7-4-9-22-16/h3,5-6,11,13,16H,4,7-10,12H2,1-2H3,(H2,18,19,20)/t13-,16-/m0/s1 |
| InChIKey | VCCMVLMTDCUPLV-BBRMVZONSA-N |
| XLogP | 2.79 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |