C25H22ClN5O3 — CID 55877892
N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide (PubChem CID 55877892) has the molecular formula C25H22ClN5O3 and a molecular weight of 475.94 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide.
| Compound Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55877892 |
| Molecular Formula | C25H22ClN5O3 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2cccnc2)cc1Cl |
| InChI | InChI=1S/C25H22ClN5O3/c1-34-13-12-28-24(32)20-10-9-18(14-22(20)26)29-25(33)21-16-31(19-7-3-2-4-8-19)30-23(21)17-6-5-11-27-15-17/h2-11,14-16H,12-13H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | PGKLNFKQJJCQPL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|