C23H21N5O2S — CID 55879220
N-[3-(3-cyanopropoxy)phenyl]-1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55879220) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55879220 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(-c3cccs3)cc(C(=O)Nc3cccc(OCCCC#N)c3)c12 |
| InChI | InChI=1S/C23H21N5O2S/c1-15-21-18(14-19(20-9-6-12-31-20)26-22(21)28(2)27-15)23(29)25-16-7-5-8-17(13-16)30-11-4-3-10-24/h5-9,12-14H,3-4,11H2,1-2H3,(H,25,29) |
| InChIKey | ULTONHGQEVLEEZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|