C20H15ClN4O2 — CID 55881068
6-chloro-N'-[2-(1H-indol-3-yl)acetyl]quinoline-8-carbohydrazide (PubChem CID 55881068) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is 6-chloro-N'-[2-(1H-indol-3-yl)acetyl]quinoline-8-carbohydrazide.
| Compound Name | 6-chloro-N'-[2-(1H-indol-3-yl)acetyl]quinoline-8-carbohydrazide |
|---|---|
| PubChem CID | 55881068 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 6-chloro-N'-[2-(1H-indol-3-yl)acetyl]quinoline-8-carbohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)c1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C20H15ClN4O2/c21-14-8-12-4-3-7-22-19(12)16(10-14)20(27)25-24-18(26)9-13-11-23-17-6-2-1-5-15(13)17/h1-8,10-11,23H,9H2,(H,24,26)(H,25,27) |
| InChIKey | JDLKIHMFPPAITL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|