C24H28N4O6 — CID 55882502
4-oxo-3-propan-2-yl-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]phthalazine-1-carbohydrazide (PubChem CID 55882502) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is 4-oxo-3-propan-2-yl-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-propan-2-yl-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55882502 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-oxo-3-propan-2-yl-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]phthalazine-1-carbohydrazide |
| SMILES | COc1ccc(CCC(=O)NNC(=O)c2nn(C(C)C)c(=O)c3ccccc23)c(OC)c1OC |
| InChI | InChI=1S/C24H28N4O6/c1-14(2)28-24(31)17-9-7-6-8-16(17)20(27-28)23(30)26-25-19(29)13-11-15-10-12-18(32-3)22(34-5)21(15)33-4/h6-10,12,14H,11,13H2,1-5H3,(H,25,29)(H,26,30) |
| InChIKey | GPRREYMDZQTYTO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|