C25H27N3O3 — CID 55884526
2-(2-methoxy-4-prop-2-enylphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide (PubChem CID 55884526) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide.
| Compound Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55884526 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
| SMILES | C=CCc1ccc(OCC(=O)Nc2ccc(-c3cn4c(n3)CCCC4)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-3-6-18-8-13-22(23(15-18)30-2)31-17-25(29)26-20-11-9-19(10-12-20)21-16-28-14-5-4-7-24(28)27-21/h3,8-13,15-16H,1,4-7,14,17H2,2H3,(H,26,29) |
| InChIKey | RXSLZUHQOIMNNJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|