C26H30N4O3S — CID 55885066
N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide (PubChem CID 55885066) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55885066 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)CCCC2)Nc1ccc(-c2cn3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C26H30N4O3S/c31-26(14-15-27-34(32,33)23-13-10-19-5-1-2-6-21(19)17-23)28-22-11-8-20(9-12-22)24-18-30-16-4-3-7-25(30)29-24/h8-13,17-18,27H,1-7,14-16H2,(H,28,31) |
| InChIKey | GGLSEXGODKKPRC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |