C18H13NO6S — CID 55885221
3-O-(1-benzothiophen-3-ylmethyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 55885221) has the molecular formula C18H13NO6S and a molecular weight of 371.37 g/mol. Its IUPAC name is 3-O-(1-benzothiophen-3-ylmethyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-(1-benzothiophen-3-ylmethyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55885221 |
| Molecular Formula | C18H13NO6S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 3-O-(1-benzothiophen-3-ylmethyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCc2csc3ccccc23)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13NO6S/c1-24-17(20)11-6-12(8-14(7-11)19(22)23)18(21)25-9-13-10-26-16-5-3-2-4-15(13)16/h2-8,10H,9H2,1H3 |
| InChIKey | UCLIWZQPQDMKBC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|