C22H23N5O6S — CID 55886105
4-methyl-N-[4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 55886105) has the molecular formula C22H23N5O6S and a molecular weight of 485.52 g/mol. Its IUPAC name is 4-methyl-N-[4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-methyl-N-[4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55886105 |
| Molecular Formula | C22H23N5O6S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 4-methyl-N-[4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1noc(C2CCCN(C(=O)c3ccc(NS(=O)(=O)c4ccc(C)c([N+](=O)[O-])c4)cc3)C2)n1 |
| InChI | InChI=1S/C22H23N5O6S/c1-14-5-10-19(12-20(14)27(29)30)34(31,32)25-18-8-6-16(7-9-18)22(28)26-11-3-4-17(13-26)21-23-15(2)24-33-21/h5-10,12,17,25H,3-4,11,13H2,1-2H3 |
| InChIKey | LTJIONQHEDBEEY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|