C11H16O7 — CID 558876
5-[hydroxy-[methoxy-(5-oxooxolan-2-yl)methoxy]methyl]oxolan-2-one (PubChem CID 558876) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is 5-[hydroxy-[methoxy-(5-oxooxolan-2-yl)methoxy]methyl]oxolan-2-one.
| Compound Name | 5-[hydroxy-[methoxy-(5-oxooxolan-2-yl)methoxy]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 558876 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-[hydroxy-[methoxy-(5-oxooxolan-2-yl)methoxy]methyl]oxolan-2-one |
| SMILES | COC(OC(O)C1CCC(=O)O1)C1CCC(=O)O1 |
| InChI | InChI=1S/C11H16O7/c1-15-11(7-3-5-9(13)17-7)18-10(14)6-2-4-8(12)16-6/h6-7,10-11,14H,2-5H2,1H3 |
| InChIKey | OUKPPIUZYBOFNZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|