C25H30N4O4 — CID 55888484
N-methyl-4-[3-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methylamino]-3-oxoprop-1-enyl]benzamide (PubChem CID 55888484) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-methyl-4-[3-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methylamino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[3-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methylamino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55888484 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-methyl-4-[3-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methylamino]-3-oxoprop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(C=CC(=O)NCc2cccc(NC(=O)CCN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-26-25(32)21-8-5-19(6-9-21)7-10-23(30)27-18-20-3-2-4-22(17-20)28-24(31)11-12-29-13-15-33-16-14-29/h2-10,17H,11-16,18H2,1H3,(H,26,32)(H,27,30)(H,28,31) |
| InChIKey | IYOSXSDTSIPUTP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|