C24H24N4O2S — CID 55888625
2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-naphthalen-1-yloxyethyl)acetamide (PubChem CID 55888625) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-naphthalen-1-yloxyethyl)acetamide.
| Compound Name | 2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-naphthalen-1-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 55888625 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[[4-(3,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-naphthalen-1-yloxyethyl)acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NCCOc2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C24H24N4O2S/c1-17-10-11-20(14-18(17)2)28-16-26-27-24(28)31-15-23(29)25-12-13-30-22-9-5-7-19-6-3-4-8-21(19)22/h3-11,14,16H,12-13,15H2,1-2H3,(H,25,29) |
| InChIKey | XGUOVBNJYRXKFQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|