C25H30N2O4S — CID 55888653
1-[4-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 55888653) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-[4-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 55888653 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[4-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCCC3c3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-18-6-3-4-7-23(18)24-8-5-15-27(24)25(29)21-13-16-26(17-14-21)32(30,31)22-11-9-20(10-12-22)19(2)28/h3-4,6-7,9-12,21,24H,5,8,13-17H2,1-2H3 |
| InChIKey | GPFPMZWMPZAOEO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |