C26H30N2O2 — CID 55889163
1-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 55889163) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 55889163 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-[4-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1ccccc1C1CCCN1C(=O)C1CCN(C(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N2O2/c1-20-8-5-6-11-23(20)24-12-7-17-28(24)26(30)22-15-18-27(19-16-22)25(29)14-13-21-9-3-2-4-10-21/h2-6,8-11,13-14,22,24H,7,12,15-19H2,1H3 |
| InChIKey | QKTOLPKKPWNJAA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|