C27H31N3O4 — CID 55966988
N-(4-methoxyphenyl)-1-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 55966988) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55966988 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-(4-methoxyphenyl)-1-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2C(=O)C2CCN(C(=O)/C=C/c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H31N3O4/c1-34-23-12-10-22(11-13-23)28-26(32)24-8-5-17-30(24)27(33)21-15-18-29(19-16-21)25(31)14-9-20-6-3-2-4-7-20/h2-4,6-7,9-14,21,24H,5,8,15-19H2,1H3,(H,28,32)/b14-9+ |
| InChIKey | RDPWJGLSMDANCI-NTEUORMPSA-N |
| XLogP | 3.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|