C25H31N3O5S — CID 55966869
1-(1-benzylsulfonylpiperidine-4-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 55966869) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-(1-benzylsulfonylpiperidine-4-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(1-benzylsulfonylpiperidine-4-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55966869 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-(1-benzylsulfonylpiperidine-4-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2C(=O)C2CCN(S(=O)(=O)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O5S/c1-33-22-11-9-21(10-12-22)26-24(29)23-8-5-15-28(23)25(30)20-13-16-27(17-14-20)34(31,32)18-19-6-3-2-4-7-19/h2-4,6-7,9-12,20,23H,5,8,13-18H2,1H3,(H,26,29) |
| InChIKey | RPWFWCAGZDSKDD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |