C9H14O3 — CID 558894
8-methyl-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one (PubChem CID 558894) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 8-methyl-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one.
| Compound Name | 8-methyl-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 558894 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 8-methyl-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one |
| SMILES | CC1CCOC2CCC(=O)OC12 |
| InChI | InChI=1S/C9H14O3/c1-6-4-5-11-7-2-3-8(10)12-9(6)7/h6-7,9H,2-5H2,1H3 |
| InChIKey | LBPJJSOROFASKM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |