C27H30N2O4S — CID 55889452
N-(4-methyl-2-phenylmethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55889452) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is N-(4-methyl-2-phenylmethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-(4-methyl-2-phenylmethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55889452 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-(4-methyl-2-phenylmethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCc2ccc(S(=O)(=O)N3CCCC3)cc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H30N2O4S/c1-21-9-15-25(26(19-21)33-20-23-7-3-2-4-8-23)28-27(30)16-12-22-10-13-24(14-11-22)34(31,32)29-17-5-6-18-29/h2-4,7-11,13-15,19H,5-6,12,16-18,20H2,1H3,(H,28,30) |
| InChIKey | LUXWRTFUAKYVRT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |