C23H25F2N3O2 — CID 55891516
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55891516) has the molecular formula C23H25F2N3O2 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55891516 |
| Molecular Formula | C23H25F2N3O2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(CN2CC(C(=O)Nc3cc(F)c(N4CCCC4)c(F)c3)CC2=O)cc1 |
| InChI | InChI=1S/C23H25F2N3O2/c1-15-4-6-16(7-5-15)13-28-14-17(10-21(28)29)23(30)26-18-11-19(24)22(20(25)12-18)27-8-2-3-9-27/h4-7,11-12,17H,2-3,8-10,13-14H2,1H3,(H,26,30) |
| InChIKey | HTEQGIZXUOJVTM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|