C24H29N3O2 — CID 7409309
(3S)-1-[(4-methylphenyl)methyl]-5-oxo-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 7409309) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (3S)-1-[(4-methylphenyl)methyl]-5-oxo-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[(4-methylphenyl)methyl]-5-oxo-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7409309 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (3S)-1-[(4-methylphenyl)methyl]-5-oxo-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(CN2C[C@@H](C(=O)Nc3ccc(N4CCCCC4)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-18-5-7-19(8-6-18)16-27-17-20(15-23(27)28)24(29)25-21-9-11-22(12-10-21)26-13-3-2-4-14-26/h5-12,20H,2-4,13-17H2,1H3,(H,25,29)/t20-/m0/s1 |
| InChIKey | BRFULZBLIADKPK-FQEVSTJZSA-N |
| XLogP | 3.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|