C19H18F2N4O3 — CID 55892404
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide (PubChem CID 55892404) has the molecular formula C19H18F2N4O3 and a molecular weight of 388.37 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 55892404 |
| Molecular Formula | C19H18F2N4O3 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncn(C)c(=O)c2c1C(=O)Nc1cc(F)c(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C19H18F2N4O3/c1-10-14(15-18(28-10)22-9-24(2)19(15)27)17(26)23-11-7-12(20)16(13(21)8-11)25-5-3-4-6-25/h7-9H,3-6H2,1-2H3,(H,23,26) |
| InChIKey | RPYCVMFJXUBPJA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|