C17H24N4O4 — CID 55849068
3,6-dimethyl-N-(4-morpholin-4-ylbutyl)-4-oxofuro[2,3-d]pyrimidine-5-carboxamide (PubChem CID 55849068) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3,6-dimethyl-N-(4-morpholin-4-ylbutyl)-4-oxofuro[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 3,6-dimethyl-N-(4-morpholin-4-ylbutyl)-4-oxofuro[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 55849068 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3,6-dimethyl-N-(4-morpholin-4-ylbutyl)-4-oxofuro[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncn(C)c(=O)c2c1C(=O)NCCCCN1CCOCC1 |
| InChI | InChI=1S/C17H24N4O4/c1-12-13(14-16(25-12)19-11-20(2)17(14)23)15(22)18-5-3-4-6-21-7-9-24-10-8-21/h11H,3-10H2,1-2H3,(H,18,22) |
| InChIKey | KGFYCGSAMXOPIT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|