C15H24N2O3 — CID 47136432
2,4,5-trimethyl-N-(3-morpholin-4-ylpropyl)furan-3-carboxamide (PubChem CID 47136432) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-(3-morpholin-4-ylpropyl)furan-3-carboxamide.
| Compound Name | 2,4,5-trimethyl-N-(3-morpholin-4-ylpropyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 47136432 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2,4,5-trimethyl-N-(3-morpholin-4-ylpropyl)furan-3-carboxamide |
| SMILES | Cc1oc(C)c(C(=O)NCCCN2CCOCC2)c1C |
| InChI | InChI=1S/C15H24N2O3/c1-11-12(2)20-13(3)14(11)15(18)16-5-4-6-17-7-9-19-10-8-17/h4-10H2,1-3H3,(H,16,18) |
| InChIKey | VEHYCLOTTDPAON-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|