C27H34N2O4 — CID 55895378
N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide (PubChem CID 55895378) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide.
| Compound Name | N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 55895378 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1ccc(OCC(=O)Nc2cc(C(=O)N3CC(C)CC(C)C3)ccc2C)c(OC)c1 |
| InChI | InChI=1S/C27H34N2O4/c1-6-7-21-9-11-24(25(13-21)32-5)33-17-26(30)28-23-14-22(10-8-20(23)4)27(31)29-15-18(2)12-19(3)16-29/h6,8-11,13-14,18-19H,1,7,12,15-17H2,2-5H3,(H,28,30) |
| InChIKey | BCJNNJUFJQWXRJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|