C24H30N4O3 — CID 55896170
1-(2-benzamido-3-methylbutanoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55896170) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-(2-benzamido-3-methylbutanoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-benzamido-3-methylbutanoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55896170 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-(2-benzamido-3-methylbutanoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)C1CCCN(C(=O)C(NC(=O)c2ccccc2)C(C)C)C1 |
| InChI | InChI=1S/C24H30N4O3/c1-16(2)20(26-22(29)18-10-5-4-6-11-18)24(31)28-14-8-12-19(15-28)23(30)27-21-17(3)9-7-13-25-21/h4-7,9-11,13,16,19-20H,8,12,14-15H2,1-3H3,(H,26,29)(H,25,27,30) |
| InChIKey | WYDKSDZKBGJOBV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |