C18H23ClN2O2S — CID 55898225
N-[3-(4-chlorophenoxy)propyl]-N,4-dimethyl-2-propyl-1,3-thiazole-5-carboxamide (PubChem CID 55898225) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)propyl]-N,4-dimethyl-2-propyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(4-chlorophenoxy)propyl]-N,4-dimethyl-2-propyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55898225 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[3-(4-chlorophenoxy)propyl]-N,4-dimethyl-2-propyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCc1nc(C)c(C(=O)N(C)CCCOc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-4-6-16-20-13(2)17(24-16)18(22)21(3)11-5-12-23-15-9-7-14(19)8-10-15/h7-10H,4-6,11-12H2,1-3H3 |
| InChIKey | FCSPHFVECRXVBL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|