About 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide
1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide (PubChem CID 55900121) has the molecular formula C16H12ClN5O3
and a molecular weight of 357.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide |
| PubChem CID | 55900121 |
| Molecular Formula | C16H12ClN5O3 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide |
| SMILES | O=C(NNc1ccccc1[N+](=O)[O-])c1cnn(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H12ClN5O3/c17-12-4-3-5-13(8-12)21-10-11(9-18-21)16(23)20-19-14-6-1-2-7-15(14)22(24)25/h1-10,19H,(H,20,23) |
| InChIKey | ORZYHGKYNGNIJX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide?
The IUPAC name of 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide (CID 55900121) is 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide.
What is the SMILES notation for 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide?
The canonical SMILES for 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide is O=C(NNc1ccccc1[N+](=O)[O-])c1cnn(-c2cccc(Cl)c2)c1.
What is the InChIKey of 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide?
The InChIKey is ORZYHGKYNGNIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN5O3/c17-12-4-3-5-13(8-12)21-10-11(9-18-21)16(23)20-19-14-6-1-2-7-15(14)22(24)25/h1-10,19H,(H,20,23).
What are the key properties of 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide?
1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide has a molecular weight of 357.76 g/mol, XLogP of 3.19, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-N'-(2-nitrophenyl)pyrazole-4-carbohydrazide is sourced from PubChem (CID 55900121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).