C17H17BrFNOS — CID 55900343
N-[(2-bromo-5-fluorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide (PubChem CID 55900343) has the molecular formula C17H17BrFNOS and a molecular weight of 382.30 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 55900343 |
| Molecular Formula | C17H17BrFNOS |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)NCc2cc(F)ccc2Br)c1 |
| InChI | InChI=1S/C17H17BrFNOS/c1-12-3-2-4-13(7-12)10-22-11-17(21)20-9-14-8-15(19)5-6-16(14)18/h2-8H,9-11H2,1H3,(H,20,21) |
| InChIKey | DKHHZEVGSXCMCB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |