C19H22FN3O4S — CID 55903058
N-(4-carbamoylphenyl)-5-(diethylsulfamoyl)-2-fluoro-N-methylbenzamide (PubChem CID 55903058) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-5-(diethylsulfamoyl)-2-fluoro-N-methylbenzamide.
| Compound Name | N-(4-carbamoylphenyl)-5-(diethylsulfamoyl)-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 55903058 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(4-carbamoylphenyl)-5-(diethylsulfamoyl)-2-fluoro-N-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)N(C)c2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C19H22FN3O4S/c1-4-23(5-2)28(26,27)15-10-11-17(20)16(12-15)19(25)22(3)14-8-6-13(7-9-14)18(21)24/h6-12H,4-5H2,1-3H3,(H2,21,24) |
| InChIKey | JLBTYEFHNRXFIF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |