C19H30FN3O4S — CID 35362085
N-[2-(tert-butylamino)-2-oxoethyl]-5-(diethylsulfamoyl)-N-ethyl-2-fluorobenzamide (PubChem CID 35362085) has the molecular formula C19H30FN3O4S and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-5-(diethylsulfamoyl)-N-ethyl-2-fluorobenzamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-5-(diethylsulfamoyl)-N-ethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 35362085 |
| Molecular Formula | C19H30FN3O4S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-5-(diethylsulfamoyl)-N-ethyl-2-fluorobenzamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1F |
| InChI | InChI=1S/C19H30FN3O4S/c1-7-22(13-17(24)21-19(4,5)6)18(25)15-12-14(10-11-16(15)20)28(26,27)23(8-2)9-3/h10-12H,7-9,13H2,1-6H3,(H,21,24) |
| InChIKey | GVPRPFUIPCTYCQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |