C18H28FN3O4S — CID 55605684
N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 55605684) has the molecular formula C18H28FN3O4S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55605684 |
| Molecular Formula | C18H28FN3O4S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)c1cc(S(=O)(=O)NC(C)C)ccc1F |
| InChI | InChI=1S/C18H28FN3O4S/c1-7-22(11-16(23)20-18(4,5)6)17(24)14-10-13(8-9-15(14)19)27(25,26)21-12(2)3/h8-10,12,21H,7,11H2,1-6H3,(H,20,23) |
| InChIKey | GLIRJLLDAJFTGG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |