C16H21FN2O7S — CID 56580629
methyl 2-[[2-fluoro-5-(propan-2-ylsulfamoyl)benzoyl]-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 56580629) has the molecular formula C16H21FN2O7S and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl 2-[[2-fluoro-5-(propan-2-ylsulfamoyl)benzoyl]-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[2-fluoro-5-(propan-2-ylsulfamoyl)benzoyl]-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 56580629 |
| Molecular Formula | C16H21FN2O7S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | methyl 2-[[2-fluoro-5-(propan-2-ylsulfamoyl)benzoyl]-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)c1cc(S(=O)(=O)NC(C)C)ccc1F |
| InChI | InChI=1S/C16H21FN2O7S/c1-10(2)18-27(23,24)11-5-6-13(17)12(7-11)16(22)19(8-14(20)25-3)9-15(21)26-4/h5-7,10,18H,8-9H2,1-4H3 |
| InChIKey | DVUNBMHRFAKQDV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |