C20H22Cl2N2O5S — CID 55439490
methyl 3-(4-chlorophenyl)-3-[[2-chloro-5-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate (PubChem CID 55439490) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-3-[[2-chloro-5-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-3-[[2-chloro-5-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 55439490 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-3-[[2-chloro-5-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(S(=O)(=O)NC(C)C)ccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O5S/c1-12(2)24-30(27,28)15-8-9-17(22)16(10-15)20(26)23-18(11-19(25)29-3)13-4-6-14(21)7-5-13/h4-10,12,18,24H,11H2,1-3H3,(H,23,26) |
| InChIKey | DUPNWAOHCOSNBC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |