C22H22N2O3 — CID 55903530
3-[4-(cyanomethoxy)phenyl]-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]prop-2-enamide (PubChem CID 55903530) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[4-(cyanomethoxy)phenyl]-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]prop-2-enamide.
| Compound Name | 3-[4-(cyanomethoxy)phenyl]-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55903530 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[4-(cyanomethoxy)phenyl]-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]prop-2-enamide |
| SMILES | N#CCOc1ccc(C=CC(=O)NCCOc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C22H22N2O3/c23-12-14-26-20-8-4-17(5-9-20)6-11-22(25)24-13-15-27-21-10-7-18-2-1-3-19(18)16-21/h4-11,16H,1-3,13-15H2,(H,24,25) |
| InChIKey | GFOOWEBMIXSUJU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|