C20H21BrN2O4S — CID 55904703
(E)-3-(5-bromothiophen-2-yl)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 55904703) has the molecular formula C20H21BrN2O4S and a molecular weight of 465.37 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55904703 |
| Molecular Formula | C20H21BrN2O4S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-1-[4-(2,4-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)/C=C/c3ccc(Br)s3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H21BrN2O4S/c1-26-14-3-6-16(17(13-14)27-2)20(25)23-11-9-22(10-12-23)19(24)8-5-15-4-7-18(21)28-15/h3-8,13H,9-12H2,1-2H3/b8-5+ |
| InChIKey | SYXNVATZIMMAMI-VMPITWQZSA-N |
| XLogP | 3.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|