C23H21N3O2S — CID 55905053
N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-phenylbenzenesulfonamide (PubChem CID 55905053) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 55905053 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cccc(Cn2ccnc2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c27-29(28,23-11-9-22(10-12-23)21-7-2-1-3-8-21)25-16-19-5-4-6-20(15-19)17-26-14-13-24-18-26/h1-15,18,25H,16-17H2 |
| InChIKey | QKPMCRLRQQZAQG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |